C20H39NO5 — CID 156754219
2-[2-[[2,6-dimethoxy-4-(methoxymethyl)phenyl]methoxy]ethoxy]-N-methylethanamine;ethane (PubChem CID 156754219) has the molecular formula C20H39NO5 and a molecular weight of 373.53 g/mol. Its IUPAC name is 2-[2-[[2,6-dimethoxy-4-(methoxymethyl)phenyl]methoxy]ethoxy]-N-methylethanamine;ethane.
| Compound Name | 2-[2-[[2,6-dimethoxy-4-(methoxymethyl)phenyl]methoxy]ethoxy]-N-methylethanamine;ethane |
|---|---|
| PubChem CID | 156754219 |
| Molecular Formula | C20H39NO5 |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.28 |
| IUPAC Name | 2-[2-[[2,6-dimethoxy-4-(methoxymethyl)phenyl]methoxy]ethoxy]-N-methylethanamine;ethane |
| SMILES | CC.CC.CNCCOCCOCc1c(OC)cc(COC)cc1OC |
| InChI | InChI=1S/C16H27NO5.2C2H6/c1-17-5-6-21-7-8-22-12-14-15(19-3)9-13(11-18-2)10-16(14)20-4;2*1-2/h9-10,17H,5-8,11-12H2,1-4H3;2*1-2H3 |
| InChIKey | IZMCRFOCKISCHL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|