C12H14F3NO — CID 117364513
2,4,5-trifluoro-3-(piperidin-4-ylmethyl)phenol (PubChem CID 117364513) has the molecular formula C12H14F3NO and a molecular weight of 245.24 g/mol. Its IUPAC name is 2,4,5-trifluoro-3-(piperidin-4-ylmethyl)phenol.
| Compound Name | 2,4,5-trifluoro-3-(piperidin-4-ylmethyl)phenol |
|---|---|
| PubChem CID | 117364513 |
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 2,4,5-trifluoro-3-(piperidin-4-ylmethyl)phenol |
| SMILES | Oc1cc(F)c(F)c(CC2CCNCC2)c1F |
| InChI | InChI=1S/C12H14F3NO/c13-9-6-10(17)12(15)8(11(9)14)5-7-1-3-16-4-2-7/h6-7,16-17H,1-5H2 |
| InChIKey | XAIHBGLAHQIAEM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|