C12H13F4N — CID 117117923
4-[(2,3,4,5-tetrafluorophenyl)methyl]piperidine (PubChem CID 117117923) has the molecular formula C12H13F4N and a molecular weight of 247.23 g/mol. Its IUPAC name is 4-[(2,3,4,5-tetrafluorophenyl)methyl]piperidine.
| Compound Name | 4-[(2,3,4,5-tetrafluorophenyl)methyl]piperidine |
|---|---|
| PubChem CID | 117117923 |
| Molecular Formula | C12H13F4N |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 4-[(2,3,4,5-tetrafluorophenyl)methyl]piperidine |
| SMILES | Fc1cc(CC2CCNCC2)c(F)c(F)c1F |
| InChI | InChI=1S/C12H13F4N/c13-9-6-8(10(14)12(16)11(9)15)5-7-1-3-17-4-2-7/h6-7,17H,1-5H2 |
| InChIKey | ZBWGUPNIKUHJOH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|