C13H17F2NO2S — CID 117467494
4-[(2,5-difluoro-3-methylsulfonylphenyl)methyl]piperidine (PubChem CID 117467494) has the molecular formula C13H17F2NO2S and a molecular weight of 289.35 g/mol. Its IUPAC name is 4-[(2,5-difluoro-3-methylsulfonylphenyl)methyl]piperidine.
| Compound Name | 4-[(2,5-difluoro-3-methylsulfonylphenyl)methyl]piperidine |
|---|---|
| PubChem CID | 117467494 |
| Molecular Formula | C13H17F2NO2S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4-[(2,5-difluoro-3-methylsulfonylphenyl)methyl]piperidine |
| SMILES | CS(=O)(=O)c1cc(F)cc(CC2CCNCC2)c1F |
| InChI | InChI=1S/C13H17F2NO2S/c1-19(17,18)12-8-11(14)7-10(13(12)15)6-9-2-4-16-5-3-9/h7-9,16H,2-6H2,1H3 |
| InChIKey | MFUXVWJSJACUCE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |