C9H11BrFNO2 — CID 117414379
4-bromo-5-fluoro-3-[2-(methylamino)ethyl]benzene-1,2-diol (PubChem CID 117414379) has the molecular formula C9H11BrFNO2 and a molecular weight of 264.09 g/mol. Its IUPAC name is 4-bromo-5-fluoro-3-[2-(methylamino)ethyl]benzene-1,2-diol.
| Compound Name | 4-bromo-5-fluoro-3-[2-(methylamino)ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 117414379 |
| Molecular Formula | C9H11BrFNO2 |
| Molecular Weight | 264.09 g/mol |
| Exact Mass | 263.00 |
| IUPAC Name | 4-bromo-5-fluoro-3-[2-(methylamino)ethyl]benzene-1,2-diol |
| SMILES | CNCCc1c(O)c(O)cc(F)c1Br |
| InChI | InChI=1S/C9H11BrFNO2/c1-12-3-2-5-8(10)6(11)4-7(13)9(5)14/h4,12-14H,2-3H2,1H3 |
| InChIKey | LJPNKNCCCOWDHH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.09 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|