C11H16BrNO — CID 84709440
2-bromo-3,5-dimethyl-6-[2-(methylamino)ethyl]phenol (PubChem CID 84709440) has the molecular formula C11H16BrNO and a molecular weight of 258.16 g/mol. Its IUPAC name is 2-bromo-3,5-dimethyl-6-[2-(methylamino)ethyl]phenol.
| Compound Name | 2-bromo-3,5-dimethyl-6-[2-(methylamino)ethyl]phenol |
|---|---|
| PubChem CID | 84709440 |
| Molecular Formula | C11H16BrNO |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 2-bromo-3,5-dimethyl-6-[2-(methylamino)ethyl]phenol |
| SMILES | CNCCc1c(C)cc(C)c(Br)c1O |
| InChI | InChI=1S/C11H16BrNO/c1-7-6-8(2)10(12)11(14)9(7)4-5-13-3/h6,13-14H,4-5H2,1-3H3 |
| InChIKey | XYPQJQVRXCDPSO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |