C12H15F3O — CID 174855228
6-(3,4,5-trifluorophenyl)hexan-1-ol (PubChem CID 174855228) has the molecular formula C12H15F3O and a molecular weight of 232.24 g/mol. Its IUPAC name is 6-(3,4,5-trifluorophenyl)hexan-1-ol.
| Compound Name | 6-(3,4,5-trifluorophenyl)hexan-1-ol |
|---|---|
| PubChem CID | 174855228 |
| Molecular Formula | C12H15F3O |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 6-(3,4,5-trifluorophenyl)hexan-1-ol |
| SMILES | OCCCCCCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H15F3O/c13-10-7-9(8-11(14)12(10)15)5-3-1-2-4-6-16/h7-8,16H,1-6H2 |
| InChIKey | MSGYSRBGUKKJBA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|