C8H9FO3 — CID 117276916
2-fluoro-4-(1-hydroxyethyl)benzene-1,3-diol (PubChem CID 117276916) has the molecular formula C8H9FO3 and a molecular weight of 172.15 g/mol. Its IUPAC name is 2-fluoro-4-(1-hydroxyethyl)benzene-1,3-diol.
| Compound Name | 2-fluoro-4-(1-hydroxyethyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 117276916 |
| Molecular Formula | C8H9FO3 |
| Molecular Weight | 172.15 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 2-fluoro-4-(1-hydroxyethyl)benzene-1,3-diol |
| SMILES | CC(O)c1ccc(O)c(F)c1O |
| InChI | InChI=1S/C8H9FO3/c1-4(10)5-2-3-6(11)7(9)8(5)12/h2-4,10-12H,1H3 |
| InChIKey | LVEYZZNRXFDWOT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.15 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |