C13H14O5 — CID 139591650
7,8-dihydroxy-2-[(2S)-2-hydroxypropyl]-5-methylchromen-4-one (PubChem CID 139591650) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is 7,8-dihydroxy-2-[(2S)-2-hydroxypropyl]-5-methylchromen-4-one.
| Compound Name | 7,8-dihydroxy-2-[(2S)-2-hydroxypropyl]-5-methylchromen-4-one |
|---|---|
| PubChem CID | 139591650 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 7,8-dihydroxy-2-[(2S)-2-hydroxypropyl]-5-methylchromen-4-one |
| SMILES | Cc1cc(O)c(O)c2oc(C[C@H](C)O)cc(=O)c12 |
| InChI | InChI=1S/C13H14O5/c1-6-3-10(16)12(17)13-11(6)9(15)5-8(18-13)4-7(2)14/h3,5,7,14,16-17H,4H2,1-2H3/t7-/m0/s1 |
| InChIKey | WTBXKSIEZUHVJB-ZETCQYMHSA-N |
| XLogP | 1.44 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|