C19H22O7 — CID 163080658
7-hydroxy-8-[5-hydroxy-6-(hydroxymethyl)oxan-2-yl]-5-methyl-2-(2-oxopropyl)chromen-4-one (PubChem CID 163080658) has the molecular formula C19H22O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is 7-hydroxy-8-[5-hydroxy-6-(hydroxymethyl)oxan-2-yl]-5-methyl-2-(2-oxopropyl)chromen-4-one.
| Compound Name | 7-hydroxy-8-[5-hydroxy-6-(hydroxymethyl)oxan-2-yl]-5-methyl-2-(2-oxopropyl)chromen-4-one |
|---|---|
| PubChem CID | 163080658 |
| Molecular Formula | C19H22O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 7-hydroxy-8-[5-hydroxy-6-(hydroxymethyl)oxan-2-yl]-5-methyl-2-(2-oxopropyl)chromen-4-one |
| SMILES | CC(=O)Cc1cc(=O)c2c(C)cc(O)c(C3CCC(O)C(CO)O3)c2o1 |
| InChI | InChI=1S/C19H22O7/c1-9-5-13(23)18(15-4-3-12(22)16(8-20)26-15)19-17(9)14(24)7-11(25-19)6-10(2)21/h5,7,12,15-16,20,22-23H,3-4,6,8H2,1-2H3 |
| InChIKey | JLOCEGBYKFJTGE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |