C18H18Br2 — CID 170660844
5,11-dibromo-6,12-dimethyltricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene (PubChem CID 170660844) has the molecular formula C18H18Br2 and a molecular weight of 394.15 g/mol. Its IUPAC name is 5,11-dibromo-6,12-dimethyltricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene.
| Compound Name | 5,11-dibromo-6,12-dimethyltricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene |
|---|---|
| PubChem CID | 170660844 |
| Molecular Formula | C18H18Br2 |
| Molecular Weight | 394.15 g/mol |
| Exact Mass | 391.98 |
| IUPAC Name | 5,11-dibromo-6,12-dimethyltricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene |
| SMILES | Cc1c2ccc(c1Br)CCc1ccc(c(Br)c1C)CC2 |
| InChI | InChI=1S/C18H18Br2/c1-11-13-3-7-15(17(11)19)10-6-14-4-8-16(9-5-13)18(20)12(14)2/h3-4,7-8H,5-6,9-10H2,1-2H3 |
| InChIKey | LRXRXJNRRLGVLT-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.15 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |