C28H40O2 — CID 101128479
6,13-ditert-butyl-15-(ethoxymethyl)-16-methoxytricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene (PubChem CID 101128479) has the molecular formula C28H40O2 and a molecular weight of 408.63 g/mol. Its IUPAC name is 6,13-ditert-butyl-15-(ethoxymethyl)-16-methoxytricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene.
| Compound Name | 6,13-ditert-butyl-15-(ethoxymethyl)-16-methoxytricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene |
|---|---|
| PubChem CID | 101128479 |
| Molecular Formula | C28H40O2 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | 6,13-ditert-butyl-15-(ethoxymethyl)-16-methoxytricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene |
| SMILES | CCOCc1c2cc(C(C)(C)C)cc1CCc1cc(C(C)(C)C)cc(c1OC)CC2 |
| InChI | InChI=1S/C28H40O2/c1-9-30-18-25-19-10-12-21-16-24(28(5,6)7)17-22(26(21)29-8)13-11-20(25)15-23(14-19)27(2,3)4/h14-17H,9-13,18H2,1-8H3 |
| InChIKey | YWQHJZLITQGEKW-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |