C10H15ClNO5- — CID 174633129
4-carboxy-2,6-dihydroxyphenolate;trimethylazanium;chloride (PubChem CID 174633129) has the molecular formula C10H15ClNO5- and a molecular weight of 264.69 g/mol. Its IUPAC name is 4-carboxy-2,6-dihydroxyphenolate;trimethylazanium;chloride.
| Compound Name | 4-carboxy-2,6-dihydroxyphenolate;trimethylazanium;chloride |
|---|---|
| PubChem CID | 174633129 |
| Molecular Formula | C10H15ClNO5- |
| Molecular Weight | 264.69 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 4-carboxy-2,6-dihydroxyphenolate;trimethylazanium;chloride |
| SMILES | C[NH+](C)C.O=C(O)c1cc(O)c([O-])c(O)c1.[Cl-] |
| InChI | InChI=1S/C7H6O5.C3H9N.ClH/c8-4-1-3(7(11)12)2-5(9)6(4)10;1-4(2)3;/h1-2,8-10H,(H,11,12);1-3H3;1H/p-1 |
| InChIKey | OVVVNFCPBAXLMA-UHFFFAOYSA-M |
| XLogP | -4.37 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.69 |
| LogP ≤ 5 | -4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |