C11H16N2O5 — CID 87904175
4-carboxy-2,6-dihydroxyphenolate;piperazin-1-ium (PubChem CID 87904175) has the molecular formula C11H16N2O5 and a molecular weight of 256.26 g/mol. Its IUPAC name is 4-carboxy-2,6-dihydroxyphenolate;piperazin-1-ium.
| Compound Name | 4-carboxy-2,6-dihydroxyphenolate;piperazin-1-ium |
|---|---|
| PubChem CID | 87904175 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 4-carboxy-2,6-dihydroxyphenolate;piperazin-1-ium |
| SMILES | C1C[NH2+]CCN1.O=C(O)c1cc(O)c([O-])c(O)c1 |
| InChI | InChI=1S/C7H6O5.C4H10N2/c8-4-1-3(7(11)12)2-5(9)6(4)10;1-2-6-4-3-5-1/h1-2,8-10H,(H,11,12);5-6H,1-4H2 |
| InChIKey | KWXFZWGKEPKUAI-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 129.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |