About 4-carboxy-2,6-dihydroxyphenolate;tetraethylazanium
4-carboxy-2,6-dihydroxyphenolate;tetraethylazanium (PubChem CID 54723196) has the molecular formula C15H25NO5
and a molecular weight of 299.37 g/mol. Its IUPAC name is 4-carboxy-2,6-dihydroxyphenolate;tetraethylazanium.
Molecular Properties
| Compound Name | 4-carboxy-2,6-dihydroxyphenolate;tetraethylazanium |
| PubChem CID | 54723196 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 4-carboxy-2,6-dihydroxyphenolate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=C(O)c1cc(O)c([O-])c(O)c1 |
| InChI | InChI=1S/C8H20N.C7H6O5/c1-5-9(6-2,7-3)8-4;8-4-1-3(7(11)12)2-5(9)6(4)10/h5-8H2,1-4H3;1-2,8-10H,(H,11,12)/q+1;/p-1 |
| InChIKey | JEPHJSWMOJUDRO-UHFFFAOYSA-M |
| XLogP | 1.75 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-carboxy-2,6-dihydroxyphenolate;tetraethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-carboxy-2,6-dihydroxyphenolate;tetraethylazanium?
The IUPAC name of 4-carboxy-2,6-dihydroxyphenolate;tetraethylazanium (CID 54723196) is 4-carboxy-2,6-dihydroxyphenolate;tetraethylazanium.
What is the SMILES notation for 4-carboxy-2,6-dihydroxyphenolate;tetraethylazanium?
The canonical SMILES for 4-carboxy-2,6-dihydroxyphenolate;tetraethylazanium is CC[N+](CC)(CC)CC.O=C(O)c1cc(O)c([O-])c(O)c1.
What is the InChIKey of 4-carboxy-2,6-dihydroxyphenolate;tetraethylazanium?
The InChIKey is JEPHJSWMOJUDRO-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H20N.C7H6O5/c1-5-9(6-2,7-3)8-4;8-4-1-3(7(11)12)2-5(9)6(4)10/h5-8H2,1-4H3;1-2,8-10H,(H,11,12)/q+1;/p-1.
What are the key properties of 4-carboxy-2,6-dihydroxyphenolate;tetraethylazanium?
4-carboxy-2,6-dihydroxyphenolate;tetraethylazanium has a molecular weight of 299.37 g/mol, XLogP of 1.75, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-carboxy-2,6-dihydroxyphenolate;tetraethylazanium is sourced from PubChem (CID 54723196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).