C15H25NO5 — CID 54723196
4-carboxy-2,6-dihydroxyphenolate;tetraethylazanium (PubChem CID 54723196) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is 4-carboxy-2,6-dihydroxyphenolate;tetraethylazanium.
| Compound Name | 4-carboxy-2,6-dihydroxyphenolate;tetraethylazanium |
|---|---|
| PubChem CID | 54723196 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 4-carboxy-2,6-dihydroxyphenolate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=C(O)c1cc(O)c([O-])c(O)c1 |
| InChI | InChI=1S/C8H20N.C7H6O5/c1-5-9(6-2,7-3)8-4;8-4-1-3(7(11)12)2-5(9)6(4)10/h5-8H2,1-4H3;1-2,8-10H,(H,11,12)/q+1;/p-1 |
| InChIKey | JEPHJSWMOJUDRO-UHFFFAOYSA-M |
| XLogP | 1.75 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|