About 4-(4-carboxyphenyl)sulfanylbenzoic acid;bis(tetraethylazanium)
4-(4-carboxyphenyl)sulfanylbenzoic acid;bis(tetraethylazanium) (PubChem CID 67856181) has the molecular formula C30H50N2O4S+2
and a molecular weight of 534.81 g/mol. Its IUPAC name is 4-(4-carboxyphenyl)sulfanylbenzoic acid;bis(tetraethylazanium).
Molecular Properties
| Compound Name | 4-(4-carboxyphenyl)sulfanylbenzoic acid;bis(tetraethylazanium) |
| PubChem CID | 67856181 |
| Molecular Formula | C30H50N2O4S+2 |
| Molecular Weight | 534.81 g/mol |
| Exact Mass | 534.35 |
| IUPAC Name | 4-(4-carboxyphenyl)sulfanylbenzoic acid;bis(tetraethylazanium) |
| SMILES | CC[N+](CC)(CC)CC.CC[N+](CC)(CC)CC.O=C(O)c1ccc(Sc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C14H10O4S.2C8H20N/c15-13(16)9-1-5-11(6-2-9)19-12-7-3-10(4-8-12)14(17)18;2*1-5-9(6-2,7-3)8-4/h1-8H,(H,15,16)(H,17,18);2*5-8H2,1-4H3/q;2*+1 |
| InChIKey | BZTLEXFKWHFBAG-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 534.81 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-carboxyphenyl)sulfanylbenzoic acid;bis(tetraethylazanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-carboxyphenyl)sulfanylbenzoic acid;bis(tetraethylazanium)?
The IUPAC name of 4-(4-carboxyphenyl)sulfanylbenzoic acid;bis(tetraethylazanium) (CID 67856181) is 4-(4-carboxyphenyl)sulfanylbenzoic acid;bis(tetraethylazanium).
What is the SMILES notation for 4-(4-carboxyphenyl)sulfanylbenzoic acid;bis(tetraethylazanium)?
The canonical SMILES for 4-(4-carboxyphenyl)sulfanylbenzoic acid;bis(tetraethylazanium) is CC[N+](CC)(CC)CC.CC[N+](CC)(CC)CC.O=C(O)c1ccc(Sc2ccc(C(=O)O)cc2)cc1.
What is the InChIKey of 4-(4-carboxyphenyl)sulfanylbenzoic acid;bis(tetraethylazanium)?
The InChIKey is BZTLEXFKWHFBAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O4S.2C8H20N/c15-13(16)9-1-5-11(6-2-9)19-12-7-3-10(4-8-12)14(17)18;2*1-5-9(6-2,7-3)8-4/h1-8H,(H,15,16)(H,17,18);2*5-8H2,1-4H3/q;2*+1.
What are the key properties of 4-(4-carboxyphenyl)sulfanylbenzoic acid;bis(tetraethylazanium)?
4-(4-carboxyphenyl)sulfanylbenzoic acid;bis(tetraethylazanium) has a molecular weight of 534.81 g/mol, XLogP of 7.00, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-carboxyphenyl)sulfanylbenzoic acid;bis(tetraethylazanium) is sourced from PubChem (CID 67856181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).