C20H18O4S — CID 150765357
1-[4-[4-(2-oxobutanoyl)phenyl]sulfanylphenyl]butane-1,2-dione (PubChem CID 150765357) has the molecular formula C20H18O4S and a molecular weight of 354.43 g/mol. Its IUPAC name is 1-[4-[4-(2-oxobutanoyl)phenyl]sulfanylphenyl]butane-1,2-dione.
| Compound Name | 1-[4-[4-(2-oxobutanoyl)phenyl]sulfanylphenyl]butane-1,2-dione |
|---|---|
| PubChem CID | 150765357 |
| Molecular Formula | C20H18O4S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 1-[4-[4-(2-oxobutanoyl)phenyl]sulfanylphenyl]butane-1,2-dione |
| SMILES | CCC(=O)C(=O)c1ccc(Sc2ccc(C(=O)C(=O)CC)cc2)cc1 |
| InChI | InChI=1S/C20H18O4S/c1-3-17(21)19(23)13-5-9-15(10-6-13)25-16-11-7-14(8-12-16)20(24)18(22)4-2/h5-12H,3-4H2,1-2H3 |
| InChIKey | JYSBUXIOCSVZBI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|