C46H80O4P2S — CID 161094163
4-(4-carboxylatophenyl)sulfanylbenzoate;bis(tetrabutylphosphanium) (PubChem CID 161094163) has the molecular formula C46H80O4P2S and a molecular weight of 791.16 g/mol. Its IUPAC name is 4-(4-carboxylatophenyl)sulfanylbenzoate;bis(tetrabutylphosphanium).
| Compound Name | 4-(4-carboxylatophenyl)sulfanylbenzoate;bis(tetrabutylphosphanium) |
|---|---|
| PubChem CID | 161094163 |
| Molecular Formula | C46H80O4P2S |
| Molecular Weight | 791.16 g/mol |
| Exact Mass | 790.53 |
| IUPAC Name | 4-(4-carboxylatophenyl)sulfanylbenzoate;bis(tetrabutylphosphanium) |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCC.CCCC[P+](CCCC)(CCCC)CCCC.O=C([O-])c1ccc(Sc2ccc(C(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/2C16H36P.C14H10O4S/c2*1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;15-13(16)9-1-5-11(6-2-9)19-12-7-3-10(4-8-12)14(17)18/h2*5-16H2,1-4H3;1-8H,(H,15,16)(H,17,18)/q2*+1;/p-2 |
| InChIKey | UHOOKHQAVCYRDC-UHFFFAOYSA-L |
| XLogP | 12.97 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.16 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|