About 1-(4-iodophenyl)butane-1,2-dione
1-(4-iodophenyl)butane-1,2-dione (PubChem CID 69189379) has the molecular formula C10H9IO2
and a molecular weight of 288.08 g/mol. Its IUPAC name is 1-(4-iodophenyl)butane-1,2-dione.
Molecular Properties
| Compound Name | 1-(4-iodophenyl)butane-1,2-dione |
| PubChem CID | 69189379 |
| Molecular Formula | C10H9IO2 |
| Molecular Weight | 288.08 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | 1-(4-iodophenyl)butane-1,2-dione |
| SMILES | CCC(=O)C(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C10H9IO2/c1-2-9(12)10(13)7-3-5-8(11)6-4-7/h3-6H,2H2,1H3 |
| InChIKey | FOJGALYDASBUAF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.08 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-iodophenyl)butane-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-iodophenyl)butane-1,2-dione?
The IUPAC name of 1-(4-iodophenyl)butane-1,2-dione (CID 69189379) is 1-(4-iodophenyl)butane-1,2-dione.
What is the SMILES notation for 1-(4-iodophenyl)butane-1,2-dione?
The canonical SMILES for 1-(4-iodophenyl)butane-1,2-dione is CCC(=O)C(=O)c1ccc(I)cc1.
What is the InChIKey of 1-(4-iodophenyl)butane-1,2-dione?
The InChIKey is FOJGALYDASBUAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9IO2/c1-2-9(12)10(13)7-3-5-8(11)6-4-7/h3-6H,2H2,1H3.
What are the key properties of 1-(4-iodophenyl)butane-1,2-dione?
1-(4-iodophenyl)butane-1,2-dione has a molecular weight of 288.08 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-iodophenyl)butane-1,2-dione is sourced from PubChem (CID 69189379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).