C20H14O8S2 — CID 70563110
4-(4-carboxyphenyl)sulfanylbenzoic acid;thiophene-2,5-dicarboxylic acid (PubChem CID 70563110) has the molecular formula C20H14O8S2 and a molecular weight of 446.46 g/mol. Its IUPAC name is 4-(4-carboxyphenyl)sulfanylbenzoic acid;thiophene-2,5-dicarboxylic acid.
| Compound Name | 4-(4-carboxyphenyl)sulfanylbenzoic acid;thiophene-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 70563110 |
| Molecular Formula | C20H14O8S2 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.01 |
| IUPAC Name | 4-(4-carboxyphenyl)sulfanylbenzoic acid;thiophene-2,5-dicarboxylic acid |
| SMILES | O=C(O)c1ccc(C(=O)O)s1.O=C(O)c1ccc(Sc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C14H10O4S.C6H4O4S/c15-13(16)9-1-5-11(6-2-9)19-12-7-3-10(4-8-12)14(17)18;7-5(8)3-1-2-4(11-3)6(9)10/h1-8H,(H,15,16)(H,17,18);1-2H,(H,7,8)(H,9,10) |
| InChIKey | UFAKVCLPOYAPAI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |