C16H12N2O4S — CID 71406990
4-pyridin-4-ylpyridine;thiophene-2,5-dicarboxylic acid (PubChem CID 71406990) has the molecular formula C16H12N2O4S and a molecular weight of 328.35 g/mol. Its IUPAC name is 4-pyridin-4-ylpyridine;thiophene-2,5-dicarboxylic acid.
| Compound Name | 4-pyridin-4-ylpyridine;thiophene-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 71406990 |
| Molecular Formula | C16H12N2O4S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 4-pyridin-4-ylpyridine;thiophene-2,5-dicarboxylic acid |
| SMILES | O=C(O)c1ccc(C(=O)O)s1.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C10H8N2.C6H4O4S/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;7-5(8)3-1-2-4(11-3)6(9)10/h1-8H;1-2H,(H,7,8)(H,9,10) |
| InChIKey | XILYQIAQXBFUSF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |