C7H5BiO5+2 — CID 54698176
bismuth 4-carboxy-2,6-dihydroxyphenolate (PubChem CID 54698176) has the molecular formula C7H5BiO5+2 and a molecular weight of 378.09 g/mol. Its IUPAC name is bismuth 4-carboxy-2,6-dihydroxyphenolate.
| Compound Name | bismuth 4-carboxy-2,6-dihydroxyphenolate |
|---|---|
| PubChem CID | 54698176 |
| Molecular Formula | C7H5BiO5+2 |
| Molecular Weight | 378.09 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | bismuth 4-carboxy-2,6-dihydroxyphenolate |
| SMILES | O=C(O)c1cc(O)c([O-])c(O)c1.[Bi+3] |
| InChI | InChI=1S/C7H6O5.Bi/c8-4-1-3(7(11)12)2-5(9)6(4)10;/h1-2,8-10H,(H,11,12);/q;+3/p-1 |
| InChIKey | BEIUQZLRZPIFSS-UHFFFAOYSA-M |
| XLogP | -0.51 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.09 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |