C15H15NO5 — CID 24853967
[4-(2-aminoethyl)phenyl] 3,4,5-trihydroxybenzoate (PubChem CID 24853967) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is [4-(2-aminoethyl)phenyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [4-(2-aminoethyl)phenyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 24853967 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | [4-(2-aminoethyl)phenyl] 3,4,5-trihydroxybenzoate |
| SMILES | NCCc1ccc(OC(=O)c2cc(O)c(O)c(O)c2)cc1 |
| InChI | InChI=1S/C15H15NO5/c16-6-5-9-1-3-11(4-2-9)21-15(20)10-7-12(17)14(19)13(18)8-10/h1-4,7-8,17-19H,5-6,16H2 |
| InChIKey | NENMOTMXTXAQAJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|