C17H16F3NO7 — CID 24853966
[4-(2-aminoethyl)phenyl] 3,4,5-trihydroxybenzoate;2,2,2-trifluoroacetic acid (PubChem CID 24853966) has the molecular formula C17H16F3NO7 and a molecular weight of 403.31 g/mol. Its IUPAC name is [4-(2-aminoethyl)phenyl] 3,4,5-trihydroxybenzoate;2,2,2-trifluoroacetic acid.
| Compound Name | [4-(2-aminoethyl)phenyl] 3,4,5-trihydroxybenzoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24853966 |
| Molecular Formula | C17H16F3NO7 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | [4-(2-aminoethyl)phenyl] 3,4,5-trihydroxybenzoate;2,2,2-trifluoroacetic acid |
| SMILES | NCCc1ccc(OC(=O)c2cc(O)c(O)c(O)c2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H15NO5.C2HF3O2/c16-6-5-9-1-3-11(4-2-9)21-15(20)10-7-12(17)14(19)13(18)8-10;3-2(4,5)1(6)7/h1-4,7-8,17-19H,5-6,16H2;(H,6,7) |
| InChIKey | XXDZPSFWEDNYSK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|