C22H18F3N3O4 — CID 167797553
(4-phenyldiazenylphenyl) 4-(aminomethyl)benzoate;2,2,2-trifluoroacetic acid (PubChem CID 167797553) has the molecular formula C22H18F3N3O4 and a molecular weight of 445.40 g/mol. Its IUPAC name is (4-phenyldiazenylphenyl) 4-(aminomethyl)benzoate;2,2,2-trifluoroacetic acid.
| Compound Name | (4-phenyldiazenylphenyl) 4-(aminomethyl)benzoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167797553 |
| Molecular Formula | C22H18F3N3O4 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | (4-phenyldiazenylphenyl) 4-(aminomethyl)benzoate;2,2,2-trifluoroacetic acid |
| SMILES | NCc1ccc(C(=O)Oc2ccc(/N=N/c3ccccc3)cc2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H17N3O2.C2HF3O2/c21-14-15-6-8-16(9-7-15)20(24)25-19-12-10-18(11-13-19)23-22-17-4-2-1-3-5-17;3-2(4,5)1(6)7/h1-13H,14,21H2;(H,6,7)/b23-22+; |
| InChIKey | OIPAVKVVRANRII-PGCQSHBKSA-N |
| XLogP | 5.41 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|