C15H11F3N2O2 — CID 122398247
[4-(2,2,2-trifluoroethyldiazenyl)phenyl] benzoate (PubChem CID 122398247) has the molecular formula C15H11F3N2O2 and a molecular weight of 308.26 g/mol. Its IUPAC name is [4-(2,2,2-trifluoroethyldiazenyl)phenyl] benzoate.
| Compound Name | [4-(2,2,2-trifluoroethyldiazenyl)phenyl] benzoate |
|---|---|
| PubChem CID | 122398247 |
| Molecular Formula | C15H11F3N2O2 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | [4-(2,2,2-trifluoroethyldiazenyl)phenyl] benzoate |
| SMILES | O=C(Oc1ccc(/N=N/CC(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C15H11F3N2O2/c16-15(17,18)10-19-20-12-6-8-13(9-7-12)22-14(21)11-4-2-1-3-5-11/h1-9H,10H2/b20-19+ |
| InChIKey | HVIXIBQFPXEJRE-FMQUCBEESA-N |
| XLogP | 4.55 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|