C11H14ClNO5 — CID 68890215
[3-(2-chloroethoxy)-4,5-dimethoxyphenyl]carbamic acid (PubChem CID 68890215) has the molecular formula C11H14ClNO5 and a molecular weight of 275.69 g/mol. Its IUPAC name is [3-(2-chloroethoxy)-4,5-dimethoxyphenyl]carbamic acid.
| Compound Name | [3-(2-chloroethoxy)-4,5-dimethoxyphenyl]carbamic acid |
|---|---|
| PubChem CID | 68890215 |
| Molecular Formula | C11H14ClNO5 |
| Molecular Weight | 275.69 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | [3-(2-chloroethoxy)-4,5-dimethoxyphenyl]carbamic acid |
| SMILES | COc1cc(NC(=O)O)cc(OCCCl)c1OC |
| InChI | InChI=1S/C11H14ClNO5/c1-16-8-5-7(13-11(14)15)6-9(10(8)17-2)18-4-3-12/h5-6,13H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | XTTNQEDNVDCEDA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.69 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|