C16H11F4NO4 — CID 88887347
2,3,4,5-tetrafluoro-6-[(3-methoxy-4-methylphenyl)carbamoyl]benzoic acid (PubChem CID 88887347) has the molecular formula C16H11F4NO4 and a molecular weight of 357.26 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-6-[(3-methoxy-4-methylphenyl)carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrafluoro-6-[(3-methoxy-4-methylphenyl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 88887347 |
| Molecular Formula | C16H11F4NO4 |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 2,3,4,5-tetrafluoro-6-[(3-methoxy-4-methylphenyl)carbamoyl]benzoic acid |
| SMILES | COc1cc(NC(=O)c2c(F)c(F)c(F)c(F)c2C(=O)O)ccc1C |
| InChI | InChI=1S/C16H11F4NO4/c1-6-3-4-7(5-8(6)25-2)21-15(22)9-10(16(23)24)12(18)14(20)13(19)11(9)17/h3-5H,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | NMPVRAAAJYDKBU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|