C21H12ClF4NO4 — CID 51036938
2-[(3-chloro-4-phenylmethoxyphenyl)carbamoyl]-3,4,5,6-tetrafluorobenzoic acid (PubChem CID 51036938) has the molecular formula C21H12ClF4NO4 and a molecular weight of 453.78 g/mol. Its IUPAC name is 2-[(3-chloro-4-phenylmethoxyphenyl)carbamoyl]-3,4,5,6-tetrafluorobenzoic acid.
| Compound Name | 2-[(3-chloro-4-phenylmethoxyphenyl)carbamoyl]-3,4,5,6-tetrafluorobenzoic acid |
|---|---|
| PubChem CID | 51036938 |
| Molecular Formula | C21H12ClF4NO4 |
| Molecular Weight | 453.78 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | 2-[(3-chloro-4-phenylmethoxyphenyl)carbamoyl]-3,4,5,6-tetrafluorobenzoic acid |
| SMILES | O=C(O)c1c(F)c(F)c(F)c(F)c1C(=O)Nc1ccc(OCc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C21H12ClF4NO4/c22-12-8-11(6-7-13(12)31-9-10-4-2-1-3-5-10)27-20(28)14-15(21(29)30)17(24)19(26)18(25)16(14)23/h1-8H,9H2,(H,27,28)(H,29,30) |
| InChIKey | USTGKUXNHNUVQY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.78 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|