C22H11Br4ClF3NO4 — CID 88887329
2,3,4,5-tetrabromo-6-[[3-chloro-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]carbamoyl]benzoic acid (PubChem CID 88887329) has the molecular formula C22H11Br4ClF3NO4 and a molecular weight of 765.40 g/mol. Its IUPAC name is 2,3,4,5-tetrabromo-6-[[3-chloro-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrabromo-6-[[3-chloro-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 88887329 |
| Molecular Formula | C22H11Br4ClF3NO4 |
| Molecular Weight | 765.40 g/mol |
| Exact Mass | 760.71 |
| IUPAC Name | 2,3,4,5-tetrabromo-6-[[3-chloro-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]carbamoyl]benzoic acid |
| SMILES | O=C(O)c1c(Br)c(Br)c(Br)c(Br)c1C(=O)Nc1ccc(OCc2cccc(C(F)(F)F)c2)c(Cl)c1 |
| InChI | InChI=1S/C22H11Br4ClF3NO4/c23-16-14(15(21(33)34)17(24)19(26)18(16)25)20(32)31-11-4-5-13(12(27)7-11)35-8-9-2-1-3-10(6-9)22(28,29)30/h1-7H,8H2,(H,31,32)(H,33,34) |
| InChIKey | QMWCZAGXLSVALZ-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.40 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|