C22H14ClF3N2O7 — CID 51038446
2-[[3-chloro-4-[[3-(trifluoromethoxy)phenyl]methoxy]phenyl]carbamoyl]-4-nitrobenzoic acid (PubChem CID 51038446) has the molecular formula C22H14ClF3N2O7 and a molecular weight of 510.81 g/mol. Its IUPAC name is 2-[[3-chloro-4-[[3-(trifluoromethoxy)phenyl]methoxy]phenyl]carbamoyl]-4-nitrobenzoic acid.
| Compound Name | 2-[[3-chloro-4-[[3-(trifluoromethoxy)phenyl]methoxy]phenyl]carbamoyl]-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 51038446 |
| Molecular Formula | C22H14ClF3N2O7 |
| Molecular Weight | 510.81 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | 2-[[3-chloro-4-[[3-(trifluoromethoxy)phenyl]methoxy]phenyl]carbamoyl]-4-nitrobenzoic acid |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1C(=O)Nc1ccc(OCc2cccc(OC(F)(F)F)c2)c(Cl)c1 |
| InChI | InChI=1S/C22H14ClF3N2O7/c23-18-9-13(27-20(29)17-10-14(28(32)33)5-6-16(17)21(30)31)4-7-19(18)34-11-12-2-1-3-15(8-12)35-22(24,25)26/h1-10H,11H2,(H,27,29)(H,30,31) |
| InChIKey | TZGSFZBXBUNKJU-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.81 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|