C14H7F4NO3S — CID 163695404
2,3,4,5-tetrafluoro-6-[(4-sulfanylphenyl)carbamoyl]benzoic acid (PubChem CID 163695404) has the molecular formula C14H7F4NO3S and a molecular weight of 345.27 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-6-[(4-sulfanylphenyl)carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrafluoro-6-[(4-sulfanylphenyl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 163695404 |
| Molecular Formula | C14H7F4NO3S |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | 2,3,4,5-tetrafluoro-6-[(4-sulfanylphenyl)carbamoyl]benzoic acid |
| SMILES | O=C(O)c1c(F)c(F)c(F)c(F)c1C(=O)Nc1ccc(S)cc1 |
| InChI | InChI=1S/C14H7F4NO3S/c15-9-7(8(14(21)22)10(16)12(18)11(9)17)13(20)19-5-1-3-6(23)4-2-5/h1-4,23H,(H,19,20)(H,21,22) |
| InChIKey | JWNMEEYFEFPDPR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|