C14H6Br4FNO3 — CID 88967282
2,3,4,5-tetrabromo-6-[(4-fluorophenyl)carbamoyl]benzoic acid (PubChem CID 88967282) has the molecular formula C14H6Br4FNO3 and a molecular weight of 574.82 g/mol. Its IUPAC name is 2,3,4,5-tetrabromo-6-[(4-fluorophenyl)carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrabromo-6-[(4-fluorophenyl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 88967282 |
| Molecular Formula | C14H6Br4FNO3 |
| Molecular Weight | 574.82 g/mol |
| Exact Mass | 570.71 |
| IUPAC Name | 2,3,4,5-tetrabromo-6-[(4-fluorophenyl)carbamoyl]benzoic acid |
| SMILES | O=C(O)c1c(Br)c(Br)c(Br)c(Br)c1C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C14H6Br4FNO3/c15-9-7(8(14(22)23)10(16)12(18)11(9)17)13(21)20-6-3-1-5(19)2-4-6/h1-4H,(H,20,21)(H,22,23) |
| InChIKey | WIIAOVMPNZFILV-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.82 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|