C11H8FN3O3 — CID 14478932
N-(4-fluorophenyl)-4-hydroxy-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 14478932) has the molecular formula C11H8FN3O3 and a molecular weight of 249.20 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-hydroxy-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(4-fluorophenyl)-4-hydroxy-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 14478932 |
| Molecular Formula | C11H8FN3O3 |
| Molecular Weight | 249.20 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | N-(4-fluorophenyl)-4-hydroxy-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1c(O)nc[nH]c1=O |
| InChI | InChI=1S/C11H8FN3O3/c12-6-1-3-7(4-2-6)15-11(18)8-9(16)13-5-14-10(8)17/h1-5H,(H,15,18)(H2,13,14,16,17) |
| InChIKey | BWSOSTPVYAGLPG-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.20 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |