C9H5FN2O2S2 — CID 12025376
N-(4-fluorophenyl)-5-oxo-1,2,4-dithiazole-3-carboxamide (PubChem CID 12025376) has the molecular formula C9H5FN2O2S2 and a molecular weight of 256.28 g/mol. Its IUPAC name is N-(4-fluorophenyl)-5-oxo-1,2,4-dithiazole-3-carboxamide.
| Compound Name | N-(4-fluorophenyl)-5-oxo-1,2,4-dithiazole-3-carboxamide |
|---|---|
| PubChem CID | 12025376 |
| Molecular Formula | C9H5FN2O2S2 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | N-(4-fluorophenyl)-5-oxo-1,2,4-dithiazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1nc(=O)ss1 |
| InChI | InChI=1S/C9H5FN2O2S2/c10-5-1-3-6(4-2-5)11-7(13)8-12-9(14)16-15-8/h1-4H,(H,11,13) |
| InChIKey | LUWWNLCIPKJYDF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |