C9H7N3O2S — CID 12025379
2-oxo-N-phenyl-3H-1,3,4-thiadiazole-5-carboxamide (PubChem CID 12025379) has the molecular formula C9H7N3O2S and a molecular weight of 221.24 g/mol. Its IUPAC name is 2-oxo-N-phenyl-3H-1,3,4-thiadiazole-5-carboxamide.
| Compound Name | 2-oxo-N-phenyl-3H-1,3,4-thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 12025379 |
| Molecular Formula | C9H7N3O2S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 2-oxo-N-phenyl-3H-1,3,4-thiadiazole-5-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1n[nH]c(=O)s1 |
| InChI | InChI=1S/C9H7N3O2S/c13-7(8-11-12-9(14)15-8)10-6-4-2-1-3-5-6/h1-5H,(H,10,13)(H,12,14) |
| InChIKey | ZBWXUWRIQMSNHP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |