C11H10N4O3 — CID 118313501
2-amino-4-hydroxy-6-oxo-N-phenyl-1H-pyrimidine-5-carboxamide (PubChem CID 118313501) has the molecular formula C11H10N4O3 and a molecular weight of 246.23 g/mol. Its IUPAC name is 2-amino-4-hydroxy-6-oxo-N-phenyl-1H-pyrimidine-5-carboxamide.
| Compound Name | 2-amino-4-hydroxy-6-oxo-N-phenyl-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 118313501 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2-amino-4-hydroxy-6-oxo-N-phenyl-1H-pyrimidine-5-carboxamide |
| SMILES | Nc1nc(O)c(C(=O)Nc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C11H10N4O3/c12-11-14-9(17)7(10(18)15-11)8(16)13-6-4-2-1-3-5-6/h1-5H,(H,13,16)(H4,12,14,15,17,18) |
| InChIKey | RQKLRBYEXYMWDQ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |