C11H9ClN4O3 — CID 66758533
N-(2-amino-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)-4-chlorobenzamide (PubChem CID 66758533) has the molecular formula C11H9ClN4O3 and a molecular weight of 280.67 g/mol. Its IUPAC name is N-(2-amino-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)-4-chlorobenzamide.
| Compound Name | N-(2-amino-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)-4-chlorobenzamide |
|---|---|
| PubChem CID | 66758533 |
| Molecular Formula | C11H9ClN4O3 |
| Molecular Weight | 280.67 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | N-(2-amino-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)-4-chlorobenzamide |
| SMILES | Nc1nc(O)c(NC(=O)c2ccc(Cl)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C11H9ClN4O3/c12-6-3-1-5(2-4-6)8(17)14-7-9(18)15-11(13)16-10(7)19/h1-4H,(H,14,17)(H4,13,15,16,18,19) |
| InChIKey | AVPDKTXBEZEVAK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.67 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |