C26H14F8N4O2S2 — CID 176949941
4-amino-N-[4-[[4-[(4-amino-2,3,5,6-tetrafluorobenzoyl)amino]phenyl]disulfanyl]phenyl]-2,3,5,6-tetrafluorobenzamide (PubChem CID 176949941) has the molecular formula C26H14F8N4O2S2 and a molecular weight of 630.54 g/mol. Its IUPAC name is 4-amino-N-[4-[[4-[(4-amino-2,3,5,6-tetrafluorobenzoyl)amino]phenyl]disulfanyl]phenyl]-2,3,5,6-tetrafluorobenzamide.
| Compound Name | 4-amino-N-[4-[[4-[(4-amino-2,3,5,6-tetrafluorobenzoyl)amino]phenyl]disulfanyl]phenyl]-2,3,5,6-tetrafluorobenzamide |
|---|---|
| PubChem CID | 176949941 |
| Molecular Formula | C26H14F8N4O2S2 |
| Molecular Weight | 630.54 g/mol |
| Exact Mass | 630.04 |
| IUPAC Name | 4-amino-N-[4-[[4-[(4-amino-2,3,5,6-tetrafluorobenzoyl)amino]phenyl]disulfanyl]phenyl]-2,3,5,6-tetrafluorobenzamide |
| SMILES | Nc1c(F)c(F)c(C(=O)Nc2ccc(SSc3ccc(NC(=O)c4c(F)c(F)c(N)c(F)c4F)cc3)cc2)c(F)c1F |
| InChI | InChI=1S/C26H14F8N4O2S2/c27-15-13(16(28)20(32)23(35)19(15)31)25(39)37-9-1-5-11(6-2-9)41-42-12-7-3-10(4-8-12)38-26(40)14-17(29)21(33)24(36)22(34)18(14)30/h1-8H,35-36H2,(H,37,39)(H,38,40) |
| InChIKey | XYIBPVWKZORISJ-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.54 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|