C15H6F5NO — CID 141392987
N-(4-ethynylphenyl)-2,3,4,5,6-pentafluorobenzamide (PubChem CID 141392987) has the molecular formula C15H6F5NO and a molecular weight of 311.21 g/mol. Its IUPAC name is N-(4-ethynylphenyl)-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-(4-ethynylphenyl)-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 141392987 |
| Molecular Formula | C15H6F5NO |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | N-(4-ethynylphenyl)-2,3,4,5,6-pentafluorobenzamide |
| SMILES | C#Cc1ccc(NC(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C15H6F5NO/c1-2-7-3-5-8(6-4-7)21-15(22)9-10(16)12(18)14(20)13(19)11(9)17/h1,3-6H,(H,21,22) |
| InChIKey | WMTHBXCRSMWCRL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|