C20H11F4NO4S — CID 88891404
2-[[4-(benzenesulfinyl)phenyl]carbamoyl]-3,4,5,6-tetrafluorobenzoic acid (PubChem CID 88891404) has the molecular formula C20H11F4NO4S and a molecular weight of 437.37 g/mol. Its IUPAC name is 2-[[4-(benzenesulfinyl)phenyl]carbamoyl]-3,4,5,6-tetrafluorobenzoic acid.
| Compound Name | 2-[[4-(benzenesulfinyl)phenyl]carbamoyl]-3,4,5,6-tetrafluorobenzoic acid |
|---|---|
| PubChem CID | 88891404 |
| Molecular Formula | C20H11F4NO4S |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | 2-[[4-(benzenesulfinyl)phenyl]carbamoyl]-3,4,5,6-tetrafluorobenzoic acid |
| SMILES | O=C(O)c1c(F)c(F)c(F)c(F)c1C(=O)Nc1ccc(S(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H11F4NO4S/c21-15-13(14(20(27)28)16(22)18(24)17(15)23)19(26)25-10-6-8-12(9-7-10)30(29)11-4-2-1-3-5-11/h1-9H,(H,25,26)(H,27,28) |
| InChIKey | FOGGSBBYSVTGIE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|