C27H16F4N2O7S — CID 88891474
2,3,4,5-tetrafluoro-6-[[3-[3-(phenoxycarbonylamino)phenyl]sulfonylphenyl]carbamoyl]benzoic acid (PubChem CID 88891474) has the molecular formula C27H16F4N2O7S and a molecular weight of 588.49 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-6-[[3-[3-(phenoxycarbonylamino)phenyl]sulfonylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrafluoro-6-[[3-[3-(phenoxycarbonylamino)phenyl]sulfonylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 88891474 |
| Molecular Formula | C27H16F4N2O7S |
| Molecular Weight | 588.49 g/mol |
| Exact Mass | 588.06 |
| IUPAC Name | 2,3,4,5-tetrafluoro-6-[[3-[3-(phenoxycarbonylamino)phenyl]sulfonylphenyl]carbamoyl]benzoic acid |
| SMILES | O=C(Nc1cccc(S(=O)(=O)c2cccc(NC(=O)c3c(F)c(F)c(F)c(F)c3C(=O)O)c2)c1)Oc1ccccc1 |
| InChI | InChI=1S/C27H16F4N2O7S/c28-21-19(20(26(35)36)22(29)24(31)23(21)30)25(34)32-14-6-4-10-17(12-14)41(38,39)18-11-5-7-15(13-18)33-27(37)40-16-8-2-1-3-9-16/h1-13H,(H,32,34)(H,33,37)(H,35,36) |
| InChIKey | JRTPKNFKOASJTJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|