C11H4F5N3O — CID 5198526
2,3,4,5,6-pentafluoro-N-pyrimidin-2-ylbenzamide (PubChem CID 5198526) has the molecular formula C11H4F5N3O and a molecular weight of 289.16 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-pyrimidin-2-ylbenzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-pyrimidin-2-ylbenzamide |
|---|---|
| PubChem CID | 5198526 |
| Molecular Formula | C11H4F5N3O |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-pyrimidin-2-ylbenzamide |
| SMILES | O=C(Nc1ncccn1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H4F5N3O/c12-5-4(6(13)8(15)9(16)7(5)14)10(20)19-11-17-2-1-3-18-11/h1-3H,(H,17,18,19,20) |
| InChIKey | PWGORYOUOXPPQV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|