C12H7F4N3O — CID 101092245
1-[2,3,4,5-tetrafluoro-6-(pyrimidin-2-ylamino)phenyl]ethanone (PubChem CID 101092245) has the molecular formula C12H7F4N3O and a molecular weight of 285.20 g/mol. Its IUPAC name is 1-[2,3,4,5-tetrafluoro-6-(pyrimidin-2-ylamino)phenyl]ethanone.
| Compound Name | 1-[2,3,4,5-tetrafluoro-6-(pyrimidin-2-ylamino)phenyl]ethanone |
|---|---|
| PubChem CID | 101092245 |
| Molecular Formula | C12H7F4N3O |
| Molecular Weight | 285.20 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 1-[2,3,4,5-tetrafluoro-6-(pyrimidin-2-ylamino)phenyl]ethanone |
| SMILES | CC(=O)c1c(F)c(F)c(F)c(F)c1Nc1ncccn1 |
| InChI | InChI=1S/C12H7F4N3O/c1-5(20)6-7(13)8(14)9(15)10(16)11(6)19-12-17-3-2-4-18-12/h2-4H,1H3,(H,17,18,19) |
| InChIKey | GRUMNSMNRALCQK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.20 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|