C8H8N6O — CID 110691520
2-methyl-N-pyrimidin-2-yltriazole-4-carboxamide (PubChem CID 110691520) has the molecular formula C8H8N6O and a molecular weight of 204.19 g/mol. Its IUPAC name is 2-methyl-N-pyrimidin-2-yltriazole-4-carboxamide.
| Compound Name | 2-methyl-N-pyrimidin-2-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 110691520 |
| Molecular Formula | C8H8N6O |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 2-methyl-N-pyrimidin-2-yltriazole-4-carboxamide |
| SMILES | Cn1ncc(C(=O)Nc2ncccn2)n1 |
| InChI | InChI=1S/C8H8N6O/c1-14-11-5-6(13-14)7(15)12-8-9-3-2-4-10-8/h2-5H,1H3,(H,9,10,12,15) |
| InChIKey | XXWDOHQAQXKNEN-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |