C6H9N5O2 — CID 130519437
N-(2-amino-2-oxoethyl)-2-methyltriazole-4-carboxamide (PubChem CID 130519437) has the molecular formula C6H9N5O2 and a molecular weight of 183.17 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-2-methyltriazole-4-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-2-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 130519437 |
| Molecular Formula | C6H9N5O2 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-2-methyltriazole-4-carboxamide |
| SMILES | Cn1ncc(C(=O)NCC(N)=O)n1 |
| InChI | InChI=1S/C6H9N5O2/c1-11-9-2-4(10-11)6(13)8-3-5(7)12/h2H,3H2,1H3,(H2,7,12)(H,8,13) |
| InChIKey | HLZYVEQBDSEESK-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |