C37H32N4Si — CID 57249798
2-(10,20-diphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)ethynyl-trimethylsilane (PubChem CID 57249798) has the molecular formula C37H32N4Si and a molecular weight of 560.78 g/mol. Its IUPAC name is 2-(10,20-diphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)ethynyl-trimethylsilane.
| Compound Name | 2-(10,20-diphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 57249798 |
| Molecular Formula | C37H32N4Si |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | 2-(10,20-diphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)ethynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#CC1=c2ccc([nH]2)=C(c2ccccc2)c2ccc([nH]2)C=c2ccc([nH]2)=C(c2ccccc2)c2ccc1[nH]2 |
| InChI | InChI=1S/C37H32N4Si/c1-42(2,3)23-22-29-30-18-20-34(40-30)36(25-10-6-4-7-11-25)32-16-14-27(38-32)24-28-15-17-33(39-28)37(26-12-8-5-9-13-26)35-21-19-31(29)41-35/h4-21,24,38-41H,1-3H3 |
| InChIKey | HFSKHHOTWSRKKQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|