C38H34Br2N4O2 — CID 91354652
5,10-bis[3-(3-bromopropoxy)phenyl]-21,22,23,24-tetrahydroporphyrin (PubChem CID 91354652) has the molecular formula C38H34Br2N4O2 and a molecular weight of 738.52 g/mol. Its IUPAC name is 5,10-bis[3-(3-bromopropoxy)phenyl]-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10-bis[3-(3-bromopropoxy)phenyl]-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 91354652 |
| Molecular Formula | C38H34Br2N4O2 |
| Molecular Weight | 738.52 g/mol |
| Exact Mass | 736.10 |
| IUPAC Name | 5,10-bis[3-(3-bromopropoxy)phenyl]-21,22,23,24-tetrahydroporphyrin |
| SMILES | BrCCCOc1cccc(C2=c3ccc([nH]3)=Cc3ccc([nH]3)C=c3ccc([nH]3)=C(c3cccc(OCCCBr)c3)c3ccc2[nH]3)c1 |
| InChI | InChI=1S/C38H34Br2N4O2/c39-17-3-19-45-31-7-1-5-25(21-31)37-33-13-11-29(42-33)23-27-9-10-28(41-27)24-30-12-14-34(43-30)38(36-16-15-35(37)44-36)26-6-2-8-32(22-26)46-20-4-18-40/h1-2,5-16,21-24,41-44H,3-4,17-20H2 |
| InChIKey | BXDWLWRWEXWIJL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|