C68H72Br4N4O4 — CID 89461278
5,10,15,20-tetrakis[3-(6-bromohexoxy)phenyl]porphyrin (PubChem CID 89461278) has the molecular formula C68H72Br4N4O4 and a molecular weight of 1328.96 g/mol. Its IUPAC name is 5,10,15,20-tetrakis[3-(6-bromohexoxy)phenyl]porphyrin.
| Compound Name | 5,10,15,20-tetrakis[3-(6-bromohexoxy)phenyl]porphyrin |
|---|---|
| PubChem CID | 89461278 |
| Molecular Formula | C68H72Br4N4O4 |
| Molecular Weight | 1328.96 g/mol |
| Exact Mass | 1324.23 |
| IUPAC Name | 5,10,15,20-tetrakis[3-(6-bromohexoxy)phenyl]porphyrin |
| SMILES | BrCCCCCCOc1cccc(/C2=C3\C=CC(=N3)/C(c3cccc(OCCCCCCBr)c3)=C3/C=CC(=N3)/C(c3cccc(OCCCCCCBr)c3)=C3/C=CC(=N3)/C(c3cccc(OCCCCCCBr)c3)=C3/C=CC2=N3)c1 |
| InChI | InChI=1S/C68H72Br4N4O4/c69-37-9-1-5-13-41-77-53-25-17-21-49(45-53)65-57-29-31-59(73-57)66(50-22-18-26-54(46-50)78-42-14-6-2-10-38-70)61-33-35-63(75-61)68(52-24-20-28-56(48-52)80-44-16-8-4-12-40-72)64-36-34-62(76-64)67(60-32-30-58(65)74-60)51-23-19-27-55(47-51)79-43-15-7-3-11-39-71/h17-36,45-48H,1-16,37-44H2/b65-57-,65-58-,66-59-,66-61-,67-60-,67-62-,68-63-,68-64- |
| InChIKey | PFVDATKALBPELX-ZOUHOBQGSA-N |
| XLogP | 19.02 |
| TPSA | 86.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1328.96 |
| LogP ≤ 5 | 19.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|