C43H49N6O2+ — CID 91443772
3-[3-[15-[3-[3-(dimethylamino)propoxy]phenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]propyl-trimethylazanium (PubChem CID 91443772) has the molecular formula C43H49N6O2+ and a molecular weight of 681.90 g/mol. Its IUPAC name is 3-[3-[15-[3-[3-(dimethylamino)propoxy]phenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]propyl-trimethylazanium.
| Compound Name | 3-[3-[15-[3-[3-(dimethylamino)propoxy]phenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]propyl-trimethylazanium |
|---|---|
| PubChem CID | 91443772 |
| Molecular Formula | C43H49N6O2+ |
| Molecular Weight | 681.90 g/mol |
| Exact Mass | 681.39 |
| IUPAC Name | 3-[3-[15-[3-[3-(dimethylamino)propoxy]phenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]propyl-trimethylazanium |
| SMILES | CN(C)CCCOc1cccc(C2=c3ccc([nH]3)=Cc3ccc([nH]3)C(c3cccc(OCCC[N+](C)(C)C)c3)=c3ccc([nH]3)=Cc3ccc2[nH]3)c1 |
| InChI | InChI=1S/C43H49N6O2/c1-48(2)22-8-24-50-36-12-6-10-30(26-36)42-38-18-14-32(44-38)28-34-16-20-40(46-34)43(41-21-17-35(47-41)29-33-15-19-39(42)45-33)31-11-7-13-37(27-31)51-25-9-23-49(3,4)5/h6-7,10-21,26-29,44-47H,8-9,22-25H2,1-5H3/q+1 |
| InChIKey | PZSZBENQRCWMNO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.90 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|